اسم المنتج |
5-Bromo-2,3-difluorophenol |
الاسم المستعار |
Bromodifluorophenol5; 3-Bromo-5,6-difluorophenol; 2,3-difluoro-5-bromophenol; bis[3-(trifluoromethyl)phenyl]methanone |
الصيغة الجزيئية |
C6H3BrF2O |
الوزن الجزيئي الغرامي |
208.9882 |
InChI |
InChI=1/C6H3BrF2O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
إستراتيجية المساعدة القطرية |
186590-26-1 |
بنية جزيئية |
|
كثافة |
1.858g/cm3 |
نقطة الغليان |
212.2°C at 760 mmHg |
معامل الإنكسار |
1.549 |
نقطة الوميض |
82.1°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|