اسم المنتج |
3,5-Dihydroxybenzonitrile |
الصيغة الجزيئية |
C7H5NO2 |
الوزن الجزيئي الغرامي |
135.1201 |
InChI |
InChI=1/C7H5NO2/c8-4-5-1-6(9)3-7(10)2-5/h1-3,9-10H |
إستراتيجية المساعدة القطرية |
19179-36-3 |
المفوضية الأوروبية رقم |
242-859-6 |
بنية جزيئية |
|
كثافة |
1.42g/cm3 |
نقطة الغليان |
336.4°C at 760 mmHg |
معامل الإنكسار |
1.647 |
نقطة الوميض |
157.2°C |
خطر المصطلحات |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|