اسم المنتج |
4-Methoxythiobenzamide |
الاسم المستعار |
Benzenecarbothioamide, 4-methoxy-; Thio-p-anisamide; 4-methoxybenzenecarbothioamide |
الصيغة الجزيئية |
C8H9NOS |
الوزن الجزيئي الغرامي |
167.2282 |
InChI |
InChI=1/C8H9NOS/c1-10-7-4-2-6(3-5-7)8(9)11/h2-5H,1H3,(H2,9,11) |
إستراتيجية المساعدة القطرية |
2362-64-3 |
بنية جزيئية |
|
كثافة |
1.194g/cm3 |
نقطة الغليان |
288.5°C at 760 mmHg |
معامل الإنكسار |
1.619 |
نقطة الوميض |
128.3°C |
خطر المصطلحات |
R20/22:Harmful by inhalation and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|