اسم المنتج |
4-(4-Methylpiperazino)acetophenone |
الاسم المستعار |
Acetophenone, 4'-(4-methyl-1-piperazinyl)-; 5-23-02-00200 (Beilstein Handbook Reference); BRN 0885205; NSC 102840; p-(4-Methylpiperazino)-acetophenone; 1-(4-(4-Methylpiperazin-1-yl)phenyl)ethan-1-one; Ethanone, 1-(4-(4-methyl-1-piperazinyl)phenyl)- (9CI); 1-[4-(4-methylpiperazin-1-yl)phenyl]ethanone; 4-(4-acetylphenyl)-1-methylpiperazin-1-ium |
الصيغة الجزيئية |
C13H19N2O |
الوزن الجزيئي الغرامي |
219.3022 |
InChI |
InChI=1/C13H18N2O/c1-11(16)12-3-5-13(6-4-12)15-9-7-14(2)8-10-15/h3-6H,7-10H2,1-2H3/p+1 |
إستراتيجية المساعدة القطرية |
26586-55-0 |
المفوضية الأوروبية رقم |
247-827-5 |
بنية جزيئية |
|
درجة الإنصهار |
96-100℃ |
نقطة الغليان |
365.1°C at 760 mmHg |
نقطة الوميض |
159.1°C |
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|