اسم المنتج |
2,4-Dimethoxybenzaldoxime |
الاسم المستعار |
1-(2,4-dimethoxyphenyl)-N-hydroxymethanimine; 2,4-dimethoxybenzaldehyde oxime |
الصيغة الجزيئية |
C9H11NO3 |
الوزن الجزيئي الغرامي |
181.1885 |
InChI |
InChI=1/C9H11NO3/c1-12-8-4-3-7(6-10-11)9(5-8)13-2/h3-6,11H,1-2H3/b10-6+ |
إستراتيجية المساعدة القطرية |
31874-34-7 |
بنية جزيئية |
|
كثافة |
1.11g/cm3 |
نقطة الغليان |
304.9°C at 760 mmHg |
معامل الإنكسار |
1.501 |
نقطة الوميض |
138.2°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|