اسم المنتج |
4-Fluoro-1-iodo-2-nitrobenzene |
الاسم المستعار |
2-Iodo-5-fluoronitrobenzene; 5-fluoro-2-iodonitrobenzene; 4-Fluoro-2-Nitroiodobenzene |
الصيغة الجزيئية |
C6H5FN2O2 |
الوزن الجزيئي الغرامي |
156.1145 |
InChI |
InChI=1/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
إستراتيجية المساعدة القطرية |
364-77-2 |
المفوضية الأوروبية رقم |
206-666-0 |
بنية جزيئية |
|
كثافة |
1.448g/cm3 |
نقطة الغليان |
295.1°C at 760 mmHg |
معامل الإنكسار |
1.603 |
نقطة الوميض |
89.4°C |
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|