| اسم المنتج |
2-Amino-4-cyanopyridine |
| الاسم المستعار |
2-Aminoisonicotinonitrile; 4-Cyano-2-pyridinamine; 2-aminopyridine-4-carbonitrile |
| الصيغة الجزيئية |
C6H5N3 |
| الوزن الجزيئي الغرامي |
119.124 |
| InChI |
InChI=1/C6H5N3/c7-4-5-1-2-9-6(8)3-5/h1-3H,(H2,8,9) |
| إستراتيجية المساعدة القطرية |
42182-27-4 |
| بنية جزيئية |
|
| كثافة |
1.23g/cm3 |
| نقطة الغليان |
297.7°C at 760 mmHg |
| معامل الإنكسار |
1.594 |
| نقطة الوميض |
133.8°C |
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
