اسم المنتج |
1-(3-fluorophenyl)-2-(3-methoxyphenyl)-1-ethanone |
الاسم المستعار |
1-(3-fluorophenyl)-2-(3-methoxyphenyl)ethanone |
الصيغة الجزيئية |
C15H13FO2 |
الوزن الجزيئي الغرامي |
244.2609 |
InChI |
InChI=1/C15H13FO2/c1-18-14-7-2-4-11(8-14)9-15(17)12-5-3-6-13(16)10-12/h2-8,10H,9H2,1H3 |
إستراتيجية المساعدة القطرية |
465514-80-1 |
بنية جزيئية |
|
كثافة |
1.163g/cm3 |
نقطة الغليان |
367.4°C at 760 mmHg |
معامل الإنكسار |
1.555 |
نقطة الوميض |
170°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|