اسم المنتج |
5-Bromobenzo[b]thiophene |
الاسم المستعار |
5-Bromothianaphthene; 5-bromo-1-benzothiophene; 5-Bromobenzo[b]thioophene; 5-Bromobenzothiophene; ; BUTTPARK 98\04-80; Benzo[c]thiophene, 5-bromo- |
الصيغة الجزيئية |
C8H5BrS |
الوزن الجزيئي الغرامي |
213.0943 |
InChI |
InChI=1/C8H5BrS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H |
إستراتيجية المساعدة القطرية |
4923-87-9;133150-64-8 |
بنية جزيئية |
|
كثافة |
1.649g/cm3 |
درجة الإنصهار |
46℃ |
نقطة الغليان |
284.7°C at 760 mmHg |
معامل الإنكسار |
1.704 |
نقطة الوميض |
126°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|