اسم المنتج |
2,4,6-trifluoropyrimidine |
الاسم المستعار |
2,4,6-Trifluoropyrimidine |
الصيغة الجزيئية |
C4HF3N2 |
الوزن الجزيئي الغرامي |
134.0593 |
InChI |
InChI=1/C4HF3N2/c5-2-1-3(6)9-4(7)8-2/h1H |
إستراتيجية المساعدة القطرية |
696-82-2 |
المفوضية الأوروبية رقم |
211-801-1 |
بنية جزيئية |
|
كثافة |
1.514g/cm3 |
نقطة الغليان |
195.6°C at 760 mmHg |
معامل الإنكسار |
1.42 |
نقطة الوميض |
72.1°C |
خطر المصطلحات |
R34:Causes burns.;
R37:Irritating to respiratory system.;
|
شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|