اسم المنتج |
2-Bromo-4,6-dichloroaniline |
الاسم المستعار |
2-bromo-1-(4-cyclohexylphenyl)ethanone; Benzenamine, 2-bromo-4,6-dichloro- |
الصيغة الجزيئية |
C6H4BrCl2N |
الوزن الجزيئي الغرامي |
240.9127 |
InChI |
InChI=1/C6H4BrCl2N/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,10H2 |
إستراتيجية المساعدة القطرية |
697-86-9 |
بنية جزيئية |
|
كثافة |
1.827g/cm3 |
نقطة الغليان |
273°C at 760 mmHg |
معامل الإنكسار |
1.648 |
نقطة الوميض |
121.8°C |
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
شروط الأمن |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|