| اسم المنتج |
9-chloroanthracene |
| الاسم المستعار |
Anthracene, 9-chloro-; 9-Chloroanthracene; CCRIS 5547 |
| الصيغة الجزيئية |
C14H9Cl |
| الوزن الجزيئي الغرامي |
212.6743 |
| InChI |
InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
| إستراتيجية المساعدة القطرية |
716-53-0 |
| المفوضية الأوروبية رقم |
211-937-1 |
| بنية جزيئية |
|
| كثافة |
1.253g/cm3 |
| درجة الإنصهار |
103-103℃ |
| نقطة الغليان |
370.1°C at 760 mmHg |
| معامل الإنكسار |
1.717 |
| نقطة الوميض |
179.2°C |
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
