اسم المنتج |
3-Chloro-4-fluorobenzylamine |
الاسم المستعار |
1-(3-chloro-4-fluorophenyl)methanamine; 1-{4-[(4-fluorobenzyl)oxy]phenyl}ethanone; 3-Chloro-4-fluorobenzyl amine |
الصيغة الجزيئية |
C15H13FO2 |
الوزن الجزيئي الغرامي |
244.2609 |
InChI |
InChI=1/C15H13FO2/c1-11(17)13-4-8-15(9-5-13)18-10-12-2-6-14(16)7-3-12/h2-9H,10H2,1H3 |
إستراتيجية المساعدة القطرية |
72235-56-4 |
بنية جزيئية |
|
كثافة |
1.163g/cm3 |
نقطة الغليان |
382.9°C at 760 mmHg |
معامل الإنكسار |
1.555 |
نقطة الوميض |
179°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|