اسم المنتج |
4-Borono-L-phenylalanine |
الاسم المستعار |
4-Boronophenylalanine; 10B-Bpa; para-Borono-L-phenylalanine; para-Boronophenylalanine; L-Phenylalanine, 4-borono-; 4-(dihydroxyboranyl)phenylalanine; 4-(dihydroxyboranyl)-L-phenylalanine |
الصيغة الجزيئية |
C9H12BNO4 |
الوزن الجزيئي الغرامي |
209.0069 |
InChI |
InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m0/s1 |
إستراتيجية المساعدة القطرية |
76410-58-7 |
بنية جزيئية |
|
كثافة |
1.34g/cm3 |
نقطة الغليان |
449.3°C at 760 mmHg |
معامل الإنكسار |
1.59 |
نقطة الوميض |
225.5°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|