| اسم المنتج |
cis-Decahydronaphthalene |
| الاسم المستعار |
cis-bicyclo(4.4.0)decane; cis-decaline; Decahydronaphthalene; Deca hydro naphthalene; Decalin |
| الصيغة الجزيئية |
C10H18 |
| الوزن الجزيئي الغرامي |
138.2499 |
| InChI |
InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
| إستراتيجية المساعدة القطرية |
493-01-6;91-17-8 |
| المفوضية الأوروبية رقم |
202-046-9 |
| بنية جزيئية |
|
| كثافة |
0.873g/cm3 |
| درجة الإنصهار |
-31℃ |
| نقطة الغليان |
190.879°C at 760 mmHg |
| معامل الإنكسار |
1.47 |
| نقطة الوميض |
57.222°C |
| الذوبان في الماء |
6 mg/L at 20℃ |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
