| Ürün Adı |
2,4,6-Trifluorobenzotrifluoride |
| Eş anlamlı |
alpha,alpha,alpha,2,4,6-Hexafluorotoluene~1,3,5-Trifluoro-2-(trifluoromethyl)benzene; 1,3,5-trifluoro-2-(trifluoromethyl)benzene; (2,6-difluorophenyl)(4-methylphenyl)methanone |
| Moleküler Formülü |
C14H10F2O |
| Molekül Ağırlığı |
232.2254 |
| InChI |
InChI=1/C14H10F2O/c1-9-5-7-10(8-6-9)14(17)13-11(15)3-2-4-12(13)16/h2-8H,1H3 |
| CAS kayıt numarası |
122030-04-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.208g/cm3 |
| Kaynama noktası |
348.2°C at 760 mmHg |
| Kırılma indisi |
1.545 |
| Alevlenme noktası |
133.4°C |
| Tehlike Sembolleri |
 F:Highly flammable;
 Xi:Irritant;
|
| Risk Kodları |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
