Ürün Adı |
2-quinolinecarbonitrile |
Eş anlamlı |
Quinoline-2-carbonitrile; 2-Cyanoquinoline |
Moleküler Formülü |
C10H6N2 |
Molekül Ağırlığı |
154.168 |
InChI |
InChI=1/C10H6N2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H |
CAS kayıt numarası |
1436-43-7 |
EINECS |
215-865-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.21g/cm3 |
Ergime noktası |
93-95℃ |
Kaynama noktası |
323.7°C at 760 mmHg |
Kırılma indisi |
1.654 |
Alevlenme noktası |
115.5°C |
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|