Ürün Adı |
3-Bromo-N,N-dimethylaniline |
Eş anlamlı |
Benzenamine, 3-bromo-N,N-dimethyl-; 4-cyanophenyl benzoate; 3-bromo-N,N-dimethylbenzenamine |
Moleküler Formülü |
C8H10BrN |
Molekül Ağırlığı |
200.0757 |
InChI |
InChI=1/C8H10BrN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
CAS kayıt numarası |
16518-62-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.393g/cm3 |
Kaynama noktası |
259.7°C at 760 mmHg |
Kırılma indisi |
1.586 |
Alevlenme noktası |
110.8°C |
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
Güvenlik Açıklaması |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|