| Ürün Adı |
2-Bromo-1-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-ethanone |
| Eş anlamlı |
2-bromo-1-(2,3-dihydrobenzo[b][1,4]dioxin-5-yl)ethanone; 2-bromo-1-(2,3-dihydro-1,4-benzodioxin-5-yl)ethanone |
| Moleküler Formülü |
C10H9BrO3 |
| Molekül Ağırlığı |
257.0807 |
| InChI |
InChI=1/C10H9BrO3/c11-6-8(12)7-2-1-3-9-10(7)14-5-4-13-9/h1-3H,4-6H2 |
| CAS kayıt numarası |
19815-97-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.577g/cm3 |
| Ergime noktası |
99℃ |
| Kaynama noktası |
348.076°C at 760 mmHg |
| Kırılma indisi |
1.587 |
| Alevlenme noktası |
164.311°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
