Ürün Adı |
N,N-Diethyldiethylenetriamine |
Eş anlamlı |
N,N-Diethyldiethykenetriamine; N-(2-Diethylaminoethyl)ethylenediamine; N'-(2-aminoethyl)-N,N-diethylethane-1,2-diamine; N'-(2-ammonioethyl)-N,N-diethylethane-1,2-diaminium |
Moleküler Formülü |
C8H24N3 |
Molekül Ağırlığı |
162.2946 |
InChI |
InChI=1/C8H21N3/c1-3-11(4-2)8-7-10-6-5-9/h10H,3-9H2,1-2H3/p+3 |
CAS kayıt numarası |
24426-16-2 |
EINECS |
246-242-2 |
Moleküler Yapısı |
|
Kaynama noktası |
227°C at 760 mmHg |
Alevlenme noktası |
91.1°C |
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|