Ürün Adı |
3-Fluoro-4-methylbenzylamine |
Eş anlamlı |
1-(3-fluoro-4-methylphenyl)methanamine |
Moleküler Formülü |
C8H10FN |
Molekül Ağırlığı |
139.1701 |
InChI |
InChI=1/C8H10FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 |
CAS kayıt numarası |
261951-67-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.071g/cm3 |
Kaynama noktası |
198°C at 760 mmHg |
Kırılma indisi |
1.52 |
Alevlenme noktası |
82.4°C |
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|