2642-98-0 6-Aminochrysene

Ürün Adı	6-Aminochrysene
Eş anlamlı	6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine
Moleküler Formülü	C₁₈H₁₃N
Molekül Ağırlığı	243.3025
InChI	InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2
CAS kayıt numarası	2642-98-0
EINECS	220-149-7
Moleküler Yapısı
Yoğunluk	1.253g/cm³
Ergime noktası	206-211℃
Kaynama noktası	501.2°C at 760 mmHg
Kırılma indisi	1.813
Alevlenme noktası	286.9°C
Tehlike Sembolleri	Xn:Harmful;
Güvenlik Açıklaması	S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;