Ürün Adı |
iodotrifluoroethylene |
Eş anlamlı |
Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
Moleküler Formülü |
C2F3I |
Molekül Ağırlığı |
207.9211 |
InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
CAS kayıt numarası |
359-37-5 |
EINECS |
206-629-9 |
Moleküler Yapısı |
|
Yoğunluk |
2.311g/cm3 |
Kaynama noktası |
30°C at 760 mmHg |
Kırılma indisi |
1.457 |
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|