| Ürün Adı |
5-fluoro-2-nitrobenzaldehyde |
| Eş anlamlı |
2-Nitro-5-Fluorobenzaldehyde; 5-Fluoro-2-nitrobenzadehyde |
| Moleküler Formülü |
C8H7FO3 |
| Molekül Ağırlığı |
170.1378 |
| InChI |
InChI=1/C8H7FO3/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4H,1H3,(H,10,11) |
| CAS kayıt numarası |
395-81-3 |
| EINECS |
206-903-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.307g/cm3 |
| Ergime noktası |
92-94℃ |
| Kaynama noktası |
266.9°C at 760 mmHg |
| Kırılma indisi |
1.524 |
| Alevlenme noktası |
115.2°C |
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
