Ürün Adı |
1,2-Dimethyl-4-fluorobenzene |
Eş anlamlı |
Fluoroxylene2; Fluorooxylene; 3,4-Dimethylfluorobenzene; 4-(Trifluoromethyl)-o-xylene; 4-fluoro-1,2-dimethylbenzene; 1-fluoro-2,4-dimethylbenzene; 4-Fluoro-o-xylene |
Moleküler Formülü |
C8H9F |
Molekül Ağırlığı |
124.1555 |
InChI |
InChI=1/C8H9F/c1-6-3-4-8(9)7(2)5-6/h3-5H,1-2H3 |
CAS kayıt numarası |
452-64-2 |
Moleküler Yapısı |
|
Yoğunluk |
0.984g/cm3 |
Kaynama noktası |
144.62°C at 760 mmHg |
Kırılma indisi |
1.481 |
Alevlenme noktası |
30.873°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R10:Flammable.;
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|