Ürün Adı |
stearic acid, compound with 1,1',1''-nitrilotri(propan-2-ol) (1:1) |
Eş anlamlı |
Stearic acid, compd. with 1,1',1''-nitrilotris(2-proanol) (1:1); TIPA-Stearate; Triisopropanolamine monostearate; Octadecanoic acid, compd. with 1,1',1''-nitrilotris(2-propanol) (1:1); Stearic acid, compound with 1,1',1''-nitrilotri(propan-2-ol) (1:1); octadecanoic acid - 1,1',1''-nitrilotripropan-2-ol (1:1) |
Moleküler Formülü |
C27H57NO5 |
Molekül Ağırlığı |
475.7452 |
InChI |
InChI=1/C18H36O2.C9H21NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-7(11)4-10(5-8(2)12)6-9(3)13/h2-17H2,1H3,(H,19,20);7-9,11-13H,4-6H2,1-3H3 |
CAS kayıt numarası |
10042-67-8 |
EINECS |
233-129-8 |
Moleküler Yapısı |
|
Kaynama noktası |
359.4°C at 760 mmHg |
Alevlenme noktası |
162.4°C |
|