اسم المنتج |
Cyclopropyl phenyl carbinol |
الاسم المستعار |
alpha-Cyclopropylbenzenemethanol; Cyclopropyl phenyl carbinol~Cyclopropylphenylmethanol; alpha-Cyclopropylbenzyl alcohol; cyclopropyl(phenyl)methanol; (R)-cyclopropyl(phenyl)methanol; (S)-cyclopropyl(phenyl)methanol |
الصيغة الجزيئية |
C10H12O |
الوزن الجزيئي الغرامي |
148.2017 |
InChI |
InChI=1/C10H12O/c11-10(9-6-7-9)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2/t10-/m1/s1 |
إستراتيجية المساعدة القطرية |
1007-03-0 |
المفوضية الأوروبية رقم |
213-749-5 |
بنية جزيئية |
|
كثافة |
1.141g/cm3 |
نقطة الغليان |
248.9°C at 760 mmHg |
معامل الإنكسار |
1.602 |
نقطة الوميض |
112.2°C |
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|