اسم المنتج |
4-bromo-3-nitroanisole |
الاسم المستعار |
4-BROMO-3-NITROTHIOANISOLE; TIMTEC-BB SBB009974; 1-bromo-4-methoxy-2-nitrobenzene |
الصيغة الجزيئية |
C7H6BrNO3 |
الوزن الجزيئي الغرامي |
232.0314 |
InChI |
InChI=1/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
إستراتيجية المساعدة القطرية |
10079-53-5;5344-78-5 |
المفوضية الأوروبية رقم |
226-290-0 |
بنية جزيئية |
|
كثافة |
1.64g/cm3 |
درجة الإنصهار |
32-34℃ |
نقطة الغليان |
291°C at 760 mmHg |
معامل الإنكسار |
1.581 |
نقطة الوميض |
123°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|