نام محصول |
2-Chloro isonicotinamide |
مترادف |
6-methyl-5-nitropyridin-2(1H)-one; 2-chloropyridine-4-carboxamide |
میدان مغناطیسی |
C6H5ClN2O |
وزن مولکولی |
156.5697 |
InChI |
InChI=1/C6H5ClN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
شماره سیایاس |
100859-84-5 |
ساختار مولکولی |
|
تراکم |
1.381g/cm3 |
نقطه ذوب |
193℃ |
نقطه غلیان |
312.2°C at 760 mmHg |
ضریب شکست |
1.588 |
نقطه اشتعال |
142.6°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|