Ονομασία του προϊόντος |
4-Methylcyclohexylamine hydrochloride |
Συνώνυμα |
1-Amino-4-methylcyclohexane hydrochloride; 4-Methylcycohexylamine hydrochloride; 4-methylcyclohexanamine; 4-methylcyclohexanamine hydrochloride |
MF |
C7H16ClN |
Μοριακό βάρος |
149.6616 |
InChI |
InChI=1/C7H15N.ClH/c1-6-2-4-7(8)5-3-6;/h6-7H,2-5,8H2,1H3;1H |
CAS ΟΧΙ |
100959-19-1 |
EINECS |
228-673-8 |
Μοριακή δομή |
|
Σημείο βρασμού |
195.9°C at 760 mmHg |
Σημείο ανάφλεξης |
72.3°C |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|