상품명칭 |
N-Phenylurethane |
별명 |
Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
분자식 |
C9H11NO2 |
분자량 |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
cas번호 |
101-99-5 |
EC번호 |
202-995-9 |
분자 구조 |
|
밀도 |
1.136g/cm3 |
비등점 |
238°C at 760 mmHg |
굴절 지수 |
1.558 |
인화점 |
79.2°C |
리스크 규칙 |
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|