product Name |
N-(2-Hydroxyphenyl)piperazine |
Synonyms |
1-(2-Hydroxyphenyl)piperazine; 2-(1-Piperazino)phenol; 2-(piperazin-1-yl)phenol; 4-(2-hydroxyphenyl)piperazin-1-ium; N-(2-Hydroxyphenyl) piperazine hcl |
Molecular Formula |
C10H15N2O |
Molecular Weight |
179.2384 |
InChI |
InChI=1/C10H14N2O/c13-10-4-2-1-3-9(10)12-7-5-11-6-8-12/h1-4,11,13H,5-8H2/p+1 |
CAS Registry Number |
1011-17-2 |
EINECS |
213-782-5 |
Molecular Structure |
|
Boiling point |
328.2°C at 760 mmHg |
Flash point |
152.3°C |
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|