상품명칭 |
3,3-diethoxy-1-propyne |
별명 |
Propiolaldehyde diethyl acetal; Propargylaldehyde diethyl acetal; 3,3-diethoxyprop-1-yne; Propynal diethyl acetal |
분자식 |
C7H12O2 |
분자량 |
128.169 |
InChI |
InChI=1/C7H12O2/c1-4-7(8-5-2)9-6-3/h1,7H,5-6H2,2-3H3 |
cas번호 |
10160-87-9 |
EC번호 |
233-430-4 |
분자 구조 |
|
밀도 |
0.909g/cm3 |
비등점 |
139°C at 760 mmHg |
굴절 지수 |
1.421 |
인화점 |
32.2°C |
리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|