termék neve |
Diethyl isobutylmalonate |
Szinonimák |
Propanedioic acid, 2-(2-methylpropyl)-, 1,3-diethyl ester; AI3-05627; Malonic acid, isobutyl-, diethyl ester; NSC 68522; Propanedioic acid, (2-methylpropyl)-, diethyl ester; diethyl (2-methylpropyl)propanedioate; Isobutylmalonic Acid Diethyl Ester |
MF |
C11H20O4 |
Molekulatömeg |
216.2741 |
InChI |
InChI=1/C11H20O4/c1-5-14-10(12)9(7-8(3)4)11(13)15-6-2/h8-9H,5-7H2,1-4H3 |
CAS-szám |
10203-58-4 |
EINECS |
233-504-6 |
Molekuláris szerkezete |
|
Sűrűség |
0.992g/cm3 |
Forráspont |
255°C at 760 mmHg |
Törésmutató |
1.431 |
Gyulladáspont |
103.1°C |
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|