product Name |
2-Bromo-6-methyl-4-nitroaniline |
Molecular Formula |
C7H7BrN2O2 |
Molecular Weight |
231.0467 |
InChI |
InChI=1/C7H7BrN2O2/c1-4-2-5(10(11)12)3-6(8)7(4)9/h2-3H,9H2,1H3 |
CAS Registry Number |
102170-56-9 |
Molecular Structure |
|
Density |
1.698g/cm3 |
Melting point |
177-181℃ |
Boiling point |
366°C at 760 mmHg |
Refractive index |
1.648 |
Flash point |
175.2°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|