Naam product |
p-Tolyl disulfide |
MF |
C14H14S2 |
Molecuulgewicht |
246.391 |
InChI |
InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
CAS-nummer |
103-19-5 |
EINECS |
203-087-5 |
Moleculaire Structuur |
|
Dichtheid |
1.17g/cm3 |
Smeltpunt |
43-46℃ |
Kookpunt |
349.5°C at 760 mmHg |
Brekingsindex |
1.649 |
Vlampunt |
192.6°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|