상품명칭 |
4-Piperidinoacetophenone |
별명 |
N-(4-Acetylphenyl)piperidine; 1-[4-(piperidin-1-yl)phenyl]ethanone; 4'-PIPERIDINOACETOPHENONE |
분자식 |
C13H17NO |
분자량 |
203.2802 |
InChI |
InChI=1/C13H17NO/c1-11(15)12-5-7-13(8-6-12)14-9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
cas번호 |
10342-85-5 |
EC번호 |
233-746-2 |
분자 구조 |
|
밀도 |
1.052g/cm3 |
녹는 점 |
84-90℃ |
비등점 |
357.8°C at 760 mmHg |
굴절 지수 |
1.545 |
인화점 |
140.2°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|