product Name |
N-Benzoylimidazole |
Synonyms |
1-Benzoylimidazole; 1H-Imidazole, 1-benzoyl-; 1H-imidazol-1-yl(phenyl)methanone |
Molecular Formula |
C10H8N2O |
Molecular Weight |
172.1833 |
InChI |
InChI=1/C10H8N2O/c13-10(12-7-6-11-8-12)9-4-2-1-3-5-9/h1-8H |
CAS Registry Number |
10364-94-0 |
EINECS |
233-805-2 |
Molecular Structure |
|
Density |
1.15g/cm3 |
Boiling point |
336°C at 760 mmHg |
Refractive index |
1.604 |
Flash point |
157°C |
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|