نام محصول |
4,4'-diaminooctafluorobiphenyl |
مترادف |
2,2,3,3,5,5,6,6-Octafluoro-4,4-bibenzenamine; Octafluorobenzidine; octafluoro-4,4-biphenylenediamine; 4,4'-dibromo-2,2',3,3',5,5',6,6'-octafluorobiphenyl |
میدان مغناطیسی |
C12Br2F8 |
وزن مولکولی |
455.9236 |
InChI |
InChI=1/C12Br2F8/c13-3-9(19)5(15)1(6(16)10(3)20)2-7(17)11(21)4(14)12(22)8(2)18 |
شماره سیایاس |
1038-66-0 |
تعداد کمیسیون اروپایی |
213-861-4 |
ساختار مولکولی |
|
تراکم |
2.065g/cm3 |
نقطه ذوب |
175-179℃ |
نقطه غلیان |
295.4°C at 760 mmHg |
ضریب شکست |
1.511 |
نقطه اشتعال |
132.4°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|