Naam product |
2-Methyl-1-pentanol |
Synoniemen |
(+-)-2-Methyl-1-pentanol; (+-)-2-Methylpentanol; 2-MPOH; 2-Methylpentanol-1; 3-01-00-01665 (Beilstein Handbook Reference); AI3-21997; BRN 1718974; HSDB 2890; NSC 6250; sec-Amyl carbinol; 1-Pentanol, 2-methyl-; 2-Methylpentan-1-ol; hexan-2-ol; (2R)-2-methylpentan-1-ol; (2S)-2-methylpentan-1-ol |
MF |
C6H14O |
Molecuulgewicht |
102.1748 |
InChI |
InChI=1/C6H14O/c1-3-4-6(2)5-7/h6-7H,3-5H2,1-2H3/t6-/m0/s1 |
CAS-nummer |
105-30-6 |
EINECS |
203-285-1 |
Moleculaire Structuur |
|
Dichtheid |
0.814g/cm3 |
Kookpunt |
148°C at 760 mmHg |
Brekingsindex |
1.413 |
Vlampunt |
50.6°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R10:Flammable.;
R20/22:Harmful by inhalation and if swallowed.;
|
Veiligheid Omschrijving |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|