termék neve |
2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone |
Szinonimák |
2-bromo-1-(5-phenylthiophen-2-yl)ethanone |
MF |
C12H9BrOS |
Molekulatömeg |
281.1683 |
InChI |
InChI=1/C12H9BrOS/c13-8-10(14)12-7-6-11(15-12)9-4-2-1-3-5-9/h1-7H,8H2 |
CAS-szám |
10531-43-8 |
Molekuláris szerkezete |
|
Sűrűség |
1.488g/cm3 |
Forráspont |
407.1°C at 760 mmHg |
Törésmutató |
1.627 |
Gyulladáspont |
200°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|