Nama produk |
2-Phenoxyethyl methacrylate |
MF |
C12H14O3 |
Berat Molekul |
206.2378 |
InChI |
InChI=1/C12H14O3/c1-9(2)12(13)15-10(3)14-11-7-5-4-6-8-11/h4-8,10H,1H2,2-3H3 |
CAS NO |
10595-06-9 |
EINECS |
234-201-1 |
Struktur Molekul |
|
Kepadatan |
1.059g/cm3 |
Titik didih |
292.352°C at 760 mmHg |
Indeks bias |
1.501 |
Titik nyala |
118.277°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|