product Name |
ethyl (R)-(-)-mandelate |
Synonyms |
(-)-Ethyl mandelate; D-(-)-Mandelic acid ethyl ester; (R)-(-)-alpha-Hydroxyphenylacetic acid ethyl ester~(R)-(-)-Mandelic acid ethyl ester; ethyl (2R)-hydroxy(phenyl)ethanoate |
Molecular Formula |
C10H12O3 |
Molecular Weight |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m1/s1 |
CAS Registry Number |
10606-72-1 |
Molecular Structure |
|
Density |
1.147g/cm3 |
Melting point |
33-34℃ |
Boiling point |
254°C at 760 mmHg |
Refractive index |
1.528 |
Flash point |
118.1°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|