Nama produk |
Titanium 2-ethylhexoxide |
Sinonim |
Tetrakis(2-ethylhexyl) orthotitanate; Tetrakis(2-ethylhexyl)titanium(IV); Tetraoctyl orthotitanate; Titanium (IV) 2-ethylhexoxide; Titanium ethylhexoxide; Titanium(IV) 2-ethylhexyloxide; Titanium tetra-2-ethylhexoxide; Tetra-2-ethylhexyl titanate; Tetratitanate(2-ethyl hexanol); Titaniumtetraki(2-ethyl hexanolate); Titaniumtetra(2-ethylhexoxide) |
MF |
C32H68O4Ti |
Berat Molekul |
564.75 |
InChI |
InChI=1/C8H18O.Ti/c1-3-5-6-8(4-2)7-9;/h8-9H,3-7H2,1-2H3;/q;+4 |
CAS NO |
1070-10-6 |
EINECS |
213-969-1 |
Struktur Molekul |
|
Kepadatan |
0.927 g/mL at 25 °C(lit.) |
Titik lebur |
熔点:18-20°C |
Titik didih |
248-249 °C11 mm Hg(lit.) |
Indeks bias |
n20/D 1.479(lit.) |
Titik nyala |
160 °F |
Kod Risiko |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|