Ονομασία του προϊόντος |
2-Methyl-5-phenylfuran-3-carboxylic acid |
Συνώνυμα |
2-Methyl-5-phenyl-3-furoic acid; 2-methyl-5-phenylfuran-3-carboxylate |
MF |
C12H9O3 |
Μοριακό βάρος |
201.1986 |
InChI |
InChI=1/C12H10O3/c1-8-10(12(13)14)7-11(15-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14)/p-1 |
CAS ΟΧΙ |
108124-17-0 |
Μοριακή δομή |
|
Σημείο τήξης |
176-179℃ |
Σημείο βρασμού |
357.1°C at 760 mmHg |
Σημείο ανάφλεξης |
169.8°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|