Produkt-Name |
Methyl caprate |
Synonyme |
Methyl decanoate; Capric acid methyl ester~Decanoic acid methyl ester~Methyl decanoate; METHYLE N-CAPRINATE |
Molekulare Formel |
C11H22O2 |
Molecular Weight |
186.2912 |
InChI |
InChI=1/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 |
CAS Registry Number |
110-42-9 |
EINECS |
203-766-6 |
Molecular Structure |
|
Dichte |
0.872g/cm3 |
Schmelzpunkt |
-11--14℃ |
Siedepunkt |
224°C at 760 mmHg |
Brechungsindex |
1.426 |
Flammpunkt |
94.4°C |
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|