Naam product |
1-Bromo-2-chloro-4-fluorobenzene |
Synoniemen |
4-Bromo-3-chlorofluorobenzene; 2-Chloro-4-Fluorobromobenzene |
MF |
C6H3BrClF |
Molecuulgewicht |
209.4434 |
InChI |
InChI=1/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H |
CAS-nummer |
110407-59-5 |
Moleculaire Structuur |
|
Dichtheid |
1.719g/cm3 |
Kookpunt |
196.3°C at 760 mmHg |
Brekingsindex |
1.55 |
Vlampunt |
72.5°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|