نام محصول |
2-chloro-4,5-dimethylphenol |
مترادف |
6-Chloro-3,4-xylenol (OH=1); 6-Chloro-3,4-xylenol |
میدان مغناطیسی |
C8H9ClO |
وزن مولکولی |
156.6095 |
InChI |
InChI=1/C8H9ClO/c1-5-3-7(9)8(10)4-6(5)2/h3-4,10H,1-2H3 |
شماره سیایاس |
1124-04-5 |
تعداد کمیسیون اروپایی |
214-386-5 |
ساختار مولکولی |
|
تراکم |
1.183g/cm3 |
نقطه ذوب |
70-72℃ |
نقطه غلیان |
237°C at 760 mmHg |
ضریب شکست |
1.558 |
نقطه اشتعال |
97.1°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|