produktnavn |
methyl 4-cyanobenzoate |
Synonymer |
4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
Molekylær Formel |
C9H7NO2 |
Molekylvekt |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
CAS-nummer |
1129-35-7 |
EINECS |
214-443-4 |
Molecular Structure |
|
Tetthet |
1.18g/cm3 |
Smeltepunkt |
62℃ |
Kokepunkt |
274.9°C at 760 mmHg |
Brytningsindeks |
1.535 |
Flammepunktet |
131.2°C |
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|