Nazwa produktu: |
isopropyl 3,4,5-trihydroxybenzoate |
Synonimy |
Isopropyl gallate; Gallic acid isopropyl ester; propan-2-yl 3,4,5-trihydroxybenzoate; Isopropylgallate |
MF |
C10H12O5 |
Masie cząsteczkowej |
212.1993 |
InChI |
InChI=1/C10H12O5/c1-5(2)15-10(14)6-3-7(11)9(13)8(12)4-6/h3-5,11-13H,1-2H3 |
Nr CAS |
1138-60-9 |
EINECS |
214-515-5 |
Struktury molekularnej |
|
Gęstość |
1.36g/cm3 |
Temperatura wrzenia |
439.5°C at 760 mmHg |
Współczynnik załamania |
1.593 |
Temperatura zapłonu |
177.4°C |
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|